Skip Navigation

1.6: Relationships of Sides in 30-60-90 Right Triangles

Difficulty Level: At Grade Created by: CK-12
Atoms Practice
Estimated8 minsto complete
Practice Relationships of Sides in 30-60-90 Right Triangles
This indicates how strong in your memory this concept is
Estimated8 minsto complete
Estimated8 minsto complete
Practice Now
This indicates how strong in your memory this concept is
Turn In

You are working on a project in your Industrial Arts class. You have been instructed to design a building. You have a plastic triangular piece that helps you with straight edges and designs. This triangle has interior angles of \begin{align*}30^\circ\end{align*}30, \begin{align*}60^\circ\end{align*}60, and \begin{align*}90^\circ\end{align*}90. Laying the triangle flat on the paper, you decide to use it to help you with the right angle at the building's base.

You trace out the bottom and left edge of the triangle on the paper to serve as the side and bottom of the structure. Looking at the length of the base of the building, you see that it is 7 inches long. Can you determine what the height of the building is from this information?

Read on, and at the conclusion of this Concept you'll be able to do just that.

Watch This

James Sousa Examples: Solve a 30-60 Right Triangle


\begin{align*}30-60-90\end{align*}306090 refers to each of the angles in this special right triangle. To understand the ratios of the sides, start with an equilateral triangle with an altitude drawn from one vertex.

Recall from geometry that an altitude, \begin{align*}h\end{align*}h, cuts the opposite side directly in half. So we know that one side, the hypotenuse, is \begin{align*}2s\end{align*}2s and the shortest leg is \begin{align*}s\end{align*}s. Also, recall that the altitude is a perpendicular and angle bisector, which is why the angle at the top is split in half. To find the length of the longer leg, use the Pythagorean Theorem:

\begin{align*}s^2 + h^2 & = (2s)^2\\ s^2 + h^2 & = 4s^2\\ h^2 & = 3s^2\\ h & = s\sqrt{3}\end{align*}s2+h2s2+h2h2h=(2s)2=4s2=3s2=s3

From this we can conclude that the length of the longer leg is the length of the short leg multiplied by \begin{align*}\sqrt{3}\end{align*} or \begin{align*}s\sqrt{3}\end{align*}. Just like the isosceles right triangle, we now only need one side in order to determine the other two in a \begin{align*}30-60-90\end{align*} triangle. The ratio of the three sides is written \begin{align*}x:x\sqrt{3}:2x\end{align*}, where \begin{align*}x\end{align*} is the shortest leg, \begin{align*}x\sqrt{3}\end{align*} is the longer leg and \begin{align*}2x\end{align*} is the hypotenuse.

Notice, that the shortest side is always opposite the smallest angle and the longest side is always opposite \begin{align*}90^\circ\end{align*}.

Example A

Find the lengths of the two missing sides in the \begin{align*}30-60-90\end{align*} triangle.

Solution: Determine which side in the \begin{align*}30-60-90\end{align*} ratio is given and solve for the other two.

\begin{align*}4\sqrt{3}\end{align*} is the longer leg because it is opposite the \begin{align*}60^\circ\end{align*}. So, in the \begin{align*}x:x\sqrt{3}:2x\end{align*} ratio, \begin{align*}4\sqrt{3} = x\sqrt{3}\end{align*}, therefore \begin{align*}x = 4\end{align*} and \begin{align*}2x = 8\end{align*}. The short leg is 4 and the hypotenuse is 8.

Example B

Find the lengths of the two missing sides in the \begin{align*}30-60-90\end{align*} triangle.

Solution: Determine which side in the \begin{align*}30-60-90\end{align*} ratio is given and solve for the other two.

17 is the hypotenuse because it is opposite the right angle. In the \begin{align*}x:x\sqrt{3}:2x\end{align*} ratio, \begin{align*}17 = 2x\end{align*} and so the short leg is \begin{align*}\frac{17}{2}\end{align*} and the long leg is \begin{align*}\frac{17\sqrt{3}}{2}\end{align*}.

Example C

Find the lengths of the two missing sides in the \begin{align*}30-60-90\end{align*} triangle.

Solution: Determine which side in the \begin{align*}30-60-90\end{align*} ratio is given and solve for the other two.

15 is the long leg because it is opposite the \begin{align*}60^\circ\end{align*}. Even though 15 does not have a radical after it, we can still set it equal to \begin{align*}x\sqrt{3}\end{align*}.

\begin{align*}x\sqrt{3} & = 15\\ x & = \frac{15}{\sqrt{3}} \cdot \frac{\sqrt{3}}{\sqrt{3}} = \frac{15\sqrt{3}}{3} = 5\sqrt{3} \quad \text{So, the short leg is} \ 5\sqrt{3}.\end{align*}

Multiplying \begin{align*}5\sqrt{3}\end{align*} by 2, we get the hypotenuse length, which is \begin{align*}10\sqrt{3}\end{align*}.


30-60-90 Triangle: A 30-60-90 Triangle is a triangle with one angle equal to ninety degrees, one angle equal to thirty degrees, and one angle equal to sixty degrees.

Guided Practice

1. Find the lengths of the two missing sides in the \begin{align*}30-60-90\end{align*} triangle.

2. Find the lengths of the two missing sides in the 30-60-90 triangle below.

3. Find the angles in the \begin{align*}30-60-90\end{align*} triangle.


1. Since the given side has a length of 8 and is the side which is opposite the right angle, we know that this is the "2x" side of the triangle. Therefore, the short side of the triangle is \begin{align*}\frac{8}{2} = 4\end{align*} and the third side of the triangle is \begin{align*}4 \sqrt{3}\end{align*}.

2. We can see that the shortest side of the triangle has a length of 3 while the longest side has a length of 6 and the other side has a length of \begin{align*}3 \sqrt{3}\end{align*}. This means that the \begin{align*}30^\circ\end{align*} angle is opposite the side with length \begin{align*}3\end{align*}, the \begin{align*}60^\circ\end{align*} angle is opposite the side with length \begin{align*}3 \sqrt{3}\end{align*}, and the \begin{align*}90^\circ\end{align*} angle is opposite the side with length \begin{align*}6\end{align*}.

3. The length of the given side is \begin{align*}3\sqrt{3}\end{align*}, and is opposite the \begin{align*}60^\circ\end{align*} angle. This means that the side opposite the \begin{align*}30^\circ\end{align*} angle is \begin{align*}3\end{align*}, and the length of the side opposite the \begin{align*}90^\circ\end{align*} angle is \begin{align*}6\end{align*}

Concept Problem Solution

Since you know the ratios of sides of a 30-60-90 triangle, you know that since the bottom side has a length of \begin{align*}7\end{align*} cm, the left side must have a length of \begin{align*}7\sqrt{3} \approx 12.12\end{align*} cm.


  1. In a 30-60-90 triangle, if the shorter leg is 8, then the longer leg is __________ and the hypotenuse is ___________.
  2. In a 30-60-90 triangle, if the shorter leg is 12, then the longer leg is __________ and the hypotenuse is ___________.
  3. In a 30-60-90 triangle, if the longer leg is 10, then the shorter leg is __________ and the hypotenuse is ___________.
  4. In a 30-60-90 triangle, if the shorter leg is 16, then the longer leg is __________ and the hypotenuse is ___________.
  5. In a 30-60-90 triangle, if the longer leg is 3, then the shorter leg is __________ and the hypotenuse is ___________.
  6. In a 30-60-90 triangle, if the shorter leg is \begin{align*}x\end{align*}, then the longer leg is __________ and the hypotenuse is ___________.
  7. In a 30-60-90 triangle, if the longer leg is \begin{align*}x\end{align*}, then the shorter leg is __________ and the hypotenuse is ___________.
  8. A rectangle has sides of length 7 and \begin{align*}7 \sqrt{3}\end{align*}. What is the length of the diagonal?
  9. Two (opposite) sides of a rectangle are 15 and the diagonal is 30. What is the length of the other two sides?
  10. What is the height of an equilateral triangle with sides of length 6 in?
  11. What is the area of an equilateral triangle with sides of length 10 ft?
  12. A regular hexagon has sides of length 3 in. What is the area of the hexagon?
  13. The area of an equilateral triangle is \begin{align*}36 \sqrt{3}\end{align*}. What is the length of a side?
  14. If a road has a grade of \begin{align*}30^\circ\end{align*}, this means that its angle of elevation is \begin{align*}30^\circ\end{align*}. If you travel 3 miles on this road, how much elevation have you gained in feet (5280 ft = 1 mile)?
  15. If a road has a grade of \begin{align*}30^\circ\end{align*}, this means that its angle of elevation is \begin{align*}30^\circ\end{align*}. If you travel x miles on this road, how much elevation have you gained in feet (5280 ft = 1 mile)?

Notes/Highlights Having trouble? Report an issue.

Color Highlighted Text Notes
Show More


30-60-90 Triangle A 30-60-90 triangle is a special right triangle with angles of 30^\circ, 60^\circ, and 90^\circ.
45-45-90 Triangle A 45-45-90 triangle is a special right triangle with angles of 45^\circ, 45^\circ, and 90^\circ.

Image Attributions

Show Hide Details
Difficulty Level:
At Grade
Date Created:
Sep 26, 2012
Last Modified:
Aug 11, 2016
Files can only be attached to the latest version of Modality
Please wait...
Please wait...
Image Detail
Sizes: Medium | Original